C26H31FN4O5 — CID 55764914
N-(2,5-diethoxy-4-morpholin-4-ylphenyl)-1-[(4-fluorophenyl)methyl]-6-oxo-4,5-dihydropyridazine-3-carboxamide (PubChem CID 55764914) has the molecular formula C26H31FN4O5 and a molecular weight of 498.56 g/mol. Its IUPAC name is N-(2,5-diethoxy-4-morpholin-4-ylphenyl)-1-[(4-fluorophenyl)methyl]-6-oxo-4,5-dihydropyridazine-3-carboxamide.
| Compound Name | N-(2,5-diethoxy-4-morpholin-4-ylphenyl)-1-[(4-fluorophenyl)methyl]-6-oxo-4,5-dihydropyridazine-3-carboxamide |
|---|---|
| PubChem CID | 55764914 |
| Molecular Formula | C26H31FN4O5 |
| Molecular Weight | 498.56 g/mol |
| Exact Mass | 498.23 |
| IUPAC Name | N-(2,5-diethoxy-4-morpholin-4-ylphenyl)-1-[(4-fluorophenyl)methyl]-6-oxo-4,5-dihydropyridazine-3-carboxamide |
| SMILES | CCOc1cc(N2CCOCC2)c(OCC)cc1NC(=O)C1=NN(Cc2ccc(F)cc2)C(=O)CC1 |
| InChI | InChI=1S/C26H31FN4O5/c1-3-35-23-16-22(30-11-13-34-14-12-30)24(36-4-2)15-21(23)28-26(33)20-9-10-25(32)31(29-20)17-18-5-7-19(27)8-6-18/h5-8,15-16H,3-4,9-14,17H2,1-2H3,(H,28,33) |
| InChIKey | RHTYKGDCLSDBBG-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.56 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|