C23H26FN3O4 — CID 39984626
N-(2,5-diethoxy-4-morpholin-4-ylphenyl)-5-fluoro-1H-indole-2-carboxamide (PubChem CID 39984626) has the molecular formula C23H26FN3O4 and a molecular weight of 427.48 g/mol. Its IUPAC name is N-(2,5-diethoxy-4-morpholin-4-ylphenyl)-5-fluoro-1H-indole-2-carboxamide.
| Compound Name | N-(2,5-diethoxy-4-morpholin-4-ylphenyl)-5-fluoro-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 39984626 |
| Molecular Formula | C23H26FN3O4 |
| Molecular Weight | 427.48 g/mol |
| Exact Mass | 427.19 |
| IUPAC Name | N-(2,5-diethoxy-4-morpholin-4-ylphenyl)-5-fluoro-1H-indole-2-carboxamide |
| SMILES | CCOc1cc(N2CCOCC2)c(OCC)cc1NC(=O)c1cc2cc(F)ccc2[nH]1 |
| InChI | InChI=1S/C23H26FN3O4/c1-3-30-21-14-20(27-7-9-29-10-8-27)22(31-4-2)13-18(21)26-23(28)19-12-15-11-16(24)5-6-17(15)25-19/h5-6,11-14,25H,3-4,7-10H2,1-2H3,(H,26,28) |
| InChIKey | KNBZUZSTCXZYJM-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 75.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.48 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|