C25H26BrN5S — CID 21011976
5-(4-bromophenyl)-6-ethyl-N-[4-(4-methylpiperazin-1-yl)phenyl]thieno[2,3-d]pyrimidin-4-amine (PubChem CID 21011976) has the molecular formula C25H26BrN5S and a molecular weight of 508.49 g/mol. Its IUPAC name is 5-(4-bromophenyl)-6-ethyl-N-[4-(4-methylpiperazin-1-yl)phenyl]thieno[2,3-d]pyrimidin-4-amine.
| Compound Name | 5-(4-bromophenyl)-6-ethyl-N-[4-(4-methylpiperazin-1-yl)phenyl]thieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 21011976 |
| Molecular Formula | C25H26BrN5S |
| Molecular Weight | 508.49 g/mol |
| Exact Mass | 507.11 |
| IUPAC Name | 5-(4-bromophenyl)-6-ethyl-N-[4-(4-methylpiperazin-1-yl)phenyl]thieno[2,3-d]pyrimidin-4-amine |
| SMILES | CCc1sc2ncnc(Nc3ccc(N4CCN(C)CC4)cc3)c2c1-c1ccc(Br)cc1 |
| InChI | InChI=1S/C25H26BrN5S/c1-3-21-22(17-4-6-18(26)7-5-17)23-24(27-16-28-25(23)32-21)29-19-8-10-20(11-9-19)31-14-12-30(2)13-15-31/h4-11,16H,3,12-15H2,1-2H3,(H,27,28,29) |
| InChIKey | UAFWATOSVVJZQR-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.49 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|