C17H18BrN3OS — CID 84555575
3-[[5-(4-bromophenyl)-6-ethylthieno[2,3-d]pyrimidin-4-yl]amino]propan-1-ol (PubChem CID 84555575) has the molecular formula C17H18BrN3OS and a molecular weight of 392.32 g/mol. Its IUPAC name is 3-[[5-(4-bromophenyl)-6-ethylthieno[2,3-d]pyrimidin-4-yl]amino]propan-1-ol.
| Compound Name | 3-[[5-(4-bromophenyl)-6-ethylthieno[2,3-d]pyrimidin-4-yl]amino]propan-1-ol |
|---|---|
| PubChem CID | 84555575 |
| Molecular Formula | C17H18BrN3OS |
| Molecular Weight | 392.32 g/mol |
| Exact Mass | 391.04 |
| IUPAC Name | 3-[[5-(4-bromophenyl)-6-ethylthieno[2,3-d]pyrimidin-4-yl]amino]propan-1-ol |
| SMILES | CCc1sc2ncnc(NCCCO)c2c1-c1ccc(Br)cc1 |
| InChI | InChI=1S/C17H18BrN3OS/c1-2-13-14(11-4-6-12(18)7-5-11)15-16(19-8-3-9-22)20-10-21-17(15)23-13/h4-7,10,22H,2-3,8-9H2,1H3,(H,19,20,21) |
| InChIKey | XOCQDWOFIPIECM-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.32 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|