C18H21N3O2S — CID 28850591
2-[2-[[6-methyl-5-(4-methylphenyl)thieno[2,3-d]pyrimidin-4-yl]amino]ethoxy]ethanol (PubChem CID 28850591) has the molecular formula C18H21N3O2S and a molecular weight of 343.45 g/mol. Its IUPAC name is 2-[2-[[6-methyl-5-(4-methylphenyl)thieno[2,3-d]pyrimidin-4-yl]amino]ethoxy]ethanol.
| Compound Name | 2-[2-[[6-methyl-5-(4-methylphenyl)thieno[2,3-d]pyrimidin-4-yl]amino]ethoxy]ethanol |
|---|---|
| PubChem CID | 28850591 |
| Molecular Formula | C18H21N3O2S |
| Molecular Weight | 343.45 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | 2-[2-[[6-methyl-5-(4-methylphenyl)thieno[2,3-d]pyrimidin-4-yl]amino]ethoxy]ethanol |
| SMILES | Cc1ccc(-c2c(C)sc3ncnc(NCCOCCO)c23)cc1 |
| InChI | InChI=1S/C18H21N3O2S/c1-12-3-5-14(6-4-12)15-13(2)24-18-16(15)17(20-11-21-18)19-7-9-23-10-8-22/h3-6,11,22H,7-10H2,1-2H3,(H,19,20,21) |
| InChIKey | PBHNBGYIVZKZIB-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 67.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.45 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|