C20H25N3O2S — CID 28852653
2-[2-[[6-methyl-5-(4-propan-2-ylphenyl)thieno[2,3-d]pyrimidin-4-yl]amino]ethoxy]ethanol (PubChem CID 28852653) has the molecular formula C20H25N3O2S and a molecular weight of 371.51 g/mol. Its IUPAC name is 2-[2-[[6-methyl-5-(4-propan-2-ylphenyl)thieno[2,3-d]pyrimidin-4-yl]amino]ethoxy]ethanol.
| Compound Name | 2-[2-[[6-methyl-5-(4-propan-2-ylphenyl)thieno[2,3-d]pyrimidin-4-yl]amino]ethoxy]ethanol |
|---|---|
| PubChem CID | 28852653 |
| Molecular Formula | C20H25N3O2S |
| Molecular Weight | 371.51 g/mol |
| Exact Mass | 371.17 |
| IUPAC Name | 2-[2-[[6-methyl-5-(4-propan-2-ylphenyl)thieno[2,3-d]pyrimidin-4-yl]amino]ethoxy]ethanol |
| SMILES | Cc1sc2ncnc(NCCOCCO)c2c1-c1ccc(C(C)C)cc1 |
| InChI | InChI=1S/C20H25N3O2S/c1-13(2)15-4-6-16(7-5-15)17-14(3)26-20-18(17)19(22-12-23-20)21-8-10-25-11-9-24/h4-7,12-13,24H,8-11H2,1-3H3,(H,21,22,23) |
| InChIKey | MQBXXTSMRFCTCJ-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 67.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.51 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|