C21H20N4S — CID 28852465
4-N-[5-(4-ethylphenyl)-6-methylthieno[2,3-d]pyrimidin-4-yl]benzene-1,4-diamine (PubChem CID 28852465) has the molecular formula C21H20N4S and a molecular weight of 360.49 g/mol. Its IUPAC name is 4-N-[5-(4-ethylphenyl)-6-methylthieno[2,3-d]pyrimidin-4-yl]benzene-1,4-diamine.
| Compound Name | 4-N-[5-(4-ethylphenyl)-6-methylthieno[2,3-d]pyrimidin-4-yl]benzene-1,4-diamine |
|---|---|
| PubChem CID | 28852465 |
| Molecular Formula | C21H20N4S |
| Molecular Weight | 360.49 g/mol |
| Exact Mass | 360.14 |
| IUPAC Name | 4-N-[5-(4-ethylphenyl)-6-methylthieno[2,3-d]pyrimidin-4-yl]benzene-1,4-diamine |
| SMILES | CCc1ccc(-c2c(C)sc3ncnc(Nc4ccc(N)cc4)c23)cc1 |
| InChI | InChI=1S/C21H20N4S/c1-3-14-4-6-15(7-5-14)18-13(2)26-21-19(18)20(23-12-24-21)25-17-10-8-16(22)9-11-17/h4-12H,3,22H2,1-2H3,(H,23,24,25) |
| InChIKey | WPMNFNADJLWVSW-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.49 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|