C25H28N4OS — CID 21009360
1-N-[5-(4-ethoxyphenyl)-6-methylthieno[2,3-d]pyrimidin-4-yl]-4-N,4-N-diethylbenzene-1,4-diamine (PubChem CID 21009360) has the molecular formula C25H28N4OS and a molecular weight of 432.59 g/mol. Its IUPAC name is 1-N-[5-(4-ethoxyphenyl)-6-methylthieno[2,3-d]pyrimidin-4-yl]-4-N,4-N-diethylbenzene-1,4-diamine.
| Compound Name | 1-N-[5-(4-ethoxyphenyl)-6-methylthieno[2,3-d]pyrimidin-4-yl]-4-N,4-N-diethylbenzene-1,4-diamine |
|---|---|
| PubChem CID | 21009360 |
| Molecular Formula | C25H28N4OS |
| Molecular Weight | 432.59 g/mol |
| Exact Mass | 432.20 |
| IUPAC Name | 1-N-[5-(4-ethoxyphenyl)-6-methylthieno[2,3-d]pyrimidin-4-yl]-4-N,4-N-diethylbenzene-1,4-diamine |
| SMILES | CCOc1ccc(-c2c(C)sc3ncnc(Nc4ccc(N(CC)CC)cc4)c23)cc1 |
| InChI | InChI=1S/C25H28N4OS/c1-5-29(6-2)20-12-10-19(11-13-20)28-24-23-22(17(4)31-25(23)27-16-26-24)18-8-14-21(15-9-18)30-7-3/h8-16H,5-7H2,1-4H3,(H,26,27,28) |
| InChIKey | YEHWKMDTRQUQAG-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.59 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|