C22H20N4O4S — CID 21010533
5-(4-ethoxyphenyl)-N-(4-methoxy-3-nitrophenyl)-6-methylthieno[2,3-d]pyrimidin-4-amine (PubChem CID 21010533) has the molecular formula C22H20N4O4S and a molecular weight of 436.49 g/mol. Its IUPAC name is 5-(4-ethoxyphenyl)-N-(4-methoxy-3-nitrophenyl)-6-methylthieno[2,3-d]pyrimidin-4-amine.
| Compound Name | 5-(4-ethoxyphenyl)-N-(4-methoxy-3-nitrophenyl)-6-methylthieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 21010533 |
| Molecular Formula | C22H20N4O4S |
| Molecular Weight | 436.49 g/mol |
| Exact Mass | 436.12 |
| IUPAC Name | 5-(4-ethoxyphenyl)-N-(4-methoxy-3-nitrophenyl)-6-methylthieno[2,3-d]pyrimidin-4-amine |
| SMILES | CCOc1ccc(-c2c(C)sc3ncnc(Nc4ccc(OC)c([N+](=O)[O-])c4)c23)cc1 |
| InChI | InChI=1S/C22H20N4O4S/c1-4-30-16-8-5-14(6-9-16)19-13(2)31-22-20(19)21(23-12-24-22)25-15-7-10-18(29-3)17(11-15)26(27)28/h5-12H,4H2,1-3H3,(H,23,24,25) |
| InChIKey | GSHJJIZOJLLDEH-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 99.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.49 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|