C23H25N7OS — CID 162102482
(4-methylpiperazin-1-yl)-[4-(3H-pyrrolo[3,4-c]pyridin-6-ylamino)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-7-yl]methanone (PubChem CID 162102482) has the molecular formula C23H25N7OS and a molecular weight of 447.57 g/mol. Its IUPAC name is (4-methylpiperazin-1-yl)-[4-(3H-pyrrolo[3,4-c]pyridin-6-ylamino)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-7-yl]methanone.
| Compound Name | (4-methylpiperazin-1-yl)-[4-(3H-pyrrolo[3,4-c]pyridin-6-ylamino)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-7-yl]methanone |
|---|---|
| PubChem CID | 162102482 |
| Molecular Formula | C23H25N7OS |
| Molecular Weight | 447.57 g/mol |
| Exact Mass | 447.18 |
| IUPAC Name | (4-methylpiperazin-1-yl)-[4-(3H-pyrrolo[3,4-c]pyridin-6-ylamino)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-7-yl]methanone |
| SMILES | CN1CCN(C(=O)C2CCc3c(sc4ncnc(Nc5cc6c(cn5)CN=C6)c34)C2)CC1 |
| InChI | InChI=1S/C23H25N7OS/c1-29-4-6-30(7-5-29)23(31)14-2-3-17-18(8-14)32-22-20(17)21(26-13-27-22)28-19-9-15-10-24-11-16(15)12-25-19/h9-10,12-14H,2-8,11H2,1H3,(H,25,26,27,28) |
| InChIKey | UGZBBGGEINBXSC-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 86.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.57 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |