C27H31ClN6O2S — CID 162091374
[4-[[6-(3-chloropropoxy)-1H-isoindol-5-yl]amino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-7-yl]-(4-methylpiperazin-1-yl)methanone (PubChem CID 162091374) has the molecular formula C27H31ClN6O2S and a molecular weight of 539.11 g/mol. Its IUPAC name is [4-[[6-(3-chloropropoxy)-1H-isoindol-5-yl]amino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-7-yl]-(4-methylpiperazin-1-yl)methanone.
| Compound Name | [4-[[6-(3-chloropropoxy)-1H-isoindol-5-yl]amino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-7-yl]-(4-methylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 162091374 |
| Molecular Formula | C27H31ClN6O2S |
| Molecular Weight | 539.11 g/mol |
| Exact Mass | 538.19 |
| IUPAC Name | [4-[[6-(3-chloropropoxy)-1H-isoindol-5-yl]amino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-7-yl]-(4-methylpiperazin-1-yl)methanone |
| SMILES | CN1CCN(C(=O)C2CCc3c(sc4ncnc(Nc5cc6c(cc5OCCCCl)CN=C6)c34)C2)CC1 |
| InChI | InChI=1S/C27H31ClN6O2S/c1-33-6-8-34(9-7-33)27(35)17-3-4-20-23(13-17)37-26-24(20)25(30-16-31-26)32-21-11-18-14-29-15-19(18)12-22(21)36-10-2-5-28/h11-12,14,16-17H,2-10,13,15H2,1H3,(H,30,31,32) |
| InChIKey | YNRVWYIUSQSLAT-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 82.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.11 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|