C28H33N5O3S — CID 161377753
[(2R,6S)-2,6-dimethylmorpholin-4-yl]-[(7S)-4-[(6-propan-2-yloxy-1H-isoindol-5-yl)amino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-7-yl]methanone (PubChem CID 161377753) has the molecular formula C28H33N5O3S and a molecular weight of 519.67 g/mol. Its IUPAC name is [(2R,6S)-2,6-dimethylmorpholin-4-yl]-[(7S)-4-[(6-propan-2-yloxy-1H-isoindol-5-yl)amino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-7-yl]methanone.
| Compound Name | [(2R,6S)-2,6-dimethylmorpholin-4-yl]-[(7S)-4-[(6-propan-2-yloxy-1H-isoindol-5-yl)amino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-7-yl]methanone |
|---|---|
| PubChem CID | 161377753 |
| Molecular Formula | C28H33N5O3S |
| Molecular Weight | 519.67 g/mol |
| Exact Mass | 519.23 |
| IUPAC Name | [(2R,6S)-2,6-dimethylmorpholin-4-yl]-[(7S)-4-[(6-propan-2-yloxy-1H-isoindol-5-yl)amino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-7-yl]methanone |
| SMILES | CC(C)Oc1cc2c(cc1Nc1ncnc3sc4c(c13)CC[C@H](C(=O)N1C[C@@H](C)O[C@@H](C)C1)C4)C=NC2 |
| InChI | InChI=1S/C28H33N5O3S/c1-15(2)35-23-8-20-11-29-10-19(20)7-22(23)32-26-25-21-6-5-18(9-24(21)37-27(25)31-14-30-26)28(34)33-12-16(3)36-17(4)13-33/h7-8,10,14-18H,5-6,9,11-13H2,1-4H3,(H,30,31,32)/t16-,17+,18-/m0/s1 |
| InChIKey | KODGIJQPNBNGGL-KSZLIROESA-N |
| XLogP | 4.90 |
| TPSA | 88.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.67 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |