C25H26FN5O2S — CID 158454566
[(2S,6S)-2,6-dimethylmorpholin-4-yl]-[(7S)-4-[(6-fluoro-1H-isoindol-5-yl)amino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-7-yl]methanone (PubChem CID 158454566) has the molecular formula C25H26FN5O2S and a molecular weight of 479.58 g/mol. Its IUPAC name is [(2S,6S)-2,6-dimethylmorpholin-4-yl]-[(7S)-4-[(6-fluoro-1H-isoindol-5-yl)amino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-7-yl]methanone.
| Compound Name | [(2S,6S)-2,6-dimethylmorpholin-4-yl]-[(7S)-4-[(6-fluoro-1H-isoindol-5-yl)amino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-7-yl]methanone |
|---|---|
| PubChem CID | 158454566 |
| Molecular Formula | C25H26FN5O2S |
| Molecular Weight | 479.58 g/mol |
| Exact Mass | 479.18 |
| IUPAC Name | [(2S,6S)-2,6-dimethylmorpholin-4-yl]-[(7S)-4-[(6-fluoro-1H-isoindol-5-yl)amino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-7-yl]methanone |
| SMILES | C[C@H]1CN(C(=O)[C@H]2CCc3c(sc4ncnc(Nc5cc6c(cc5F)CN=C6)c34)C2)C[C@H](C)O1 |
| InChI | InChI=1S/C25H26FN5O2S/c1-13-10-31(11-14(2)33-13)25(32)15-3-4-18-21(7-15)34-24-22(18)23(28-12-29-24)30-20-6-17-9-27-8-16(17)5-19(20)26/h5-6,9,12-15H,3-4,7-8,10-11H2,1-2H3,(H,28,29,30)/t13-,14-,15-/m0/s1 |
| InChIKey | WQMGFUXZTZMJFB-KKUMJFAQSA-N |
| XLogP | 4.25 |
| TPSA | 79.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.58 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |