C27H33N5O2S2 — CID 123417765
(2,6-dimethylmorpholin-4-yl)-[4-[5-ethenyl-4-(methylamino)-2-methylsulfanylanilino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-7-yl]methanone (PubChem CID 123417765) has the molecular formula C27H33N5O2S2 and a molecular weight of 523.73 g/mol. Its IUPAC name is (2,6-dimethylmorpholin-4-yl)-[4-[5-ethenyl-4-(methylamino)-2-methylsulfanylanilino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-7-yl]methanone.
| Compound Name | (2,6-dimethylmorpholin-4-yl)-[4-[5-ethenyl-4-(methylamino)-2-methylsulfanylanilino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-7-yl]methanone |
|---|---|
| PubChem CID | 123417765 |
| Molecular Formula | C27H33N5O2S2 |
| Molecular Weight | 523.73 g/mol |
| Exact Mass | 523.21 |
| IUPAC Name | (2,6-dimethylmorpholin-4-yl)-[4-[5-ethenyl-4-(methylamino)-2-methylsulfanylanilino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-7-yl]methanone |
| SMILES | C=Cc1cc(Nc2ncnc3sc4c(c23)CCC(C(=O)N2CC(C)OC(C)C2)C4)c(SC)cc1NC |
| InChI | InChI=1S/C27H33N5O2S2/c1-6-17-9-21(23(35-5)11-20(17)28-4)31-25-24-19-8-7-18(10-22(19)36-26(24)30-14-29-25)27(33)32-12-15(2)34-16(3)13-32/h6,9,11,14-16,18,28H,1,7-8,10,12-13H2,2-5H3,(H,29,30,31) |
| InChIKey | JUJLAFDZIBMZTE-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.73 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |