C25H27N5O4S — CID 158053533
[(3R,4R)-3,4-dihydroxypyrrolidin-1-yl]-[(7S)-4-[(6-ethoxy-1H-isoindol-5-yl)amino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-7-yl]methanone (PubChem CID 158053533) has the molecular formula C25H27N5O4S and a molecular weight of 493.59 g/mol. Its IUPAC name is [(3R,4R)-3,4-dihydroxypyrrolidin-1-yl]-[(7S)-4-[(6-ethoxy-1H-isoindol-5-yl)amino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-7-yl]methanone.
| Compound Name | [(3R,4R)-3,4-dihydroxypyrrolidin-1-yl]-[(7S)-4-[(6-ethoxy-1H-isoindol-5-yl)amino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-7-yl]methanone |
|---|---|
| PubChem CID | 158053533 |
| Molecular Formula | C25H27N5O4S |
| Molecular Weight | 493.59 g/mol |
| Exact Mass | 493.18 |
| IUPAC Name | [(3R,4R)-3,4-dihydroxypyrrolidin-1-yl]-[(7S)-4-[(6-ethoxy-1H-isoindol-5-yl)amino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-7-yl]methanone |
| SMILES | CCOc1cc2c(cc1Nc1ncnc3sc4c(c13)CC[C@H](C(=O)N1C[C@@H](O)[C@H](O)C1)C4)C=NC2 |
| InChI | InChI=1S/C25H27N5O4S/c1-2-34-20-6-15-9-26-8-14(15)5-17(20)29-23-22-16-4-3-13(7-21(16)35-24(22)28-12-27-23)25(33)30-10-18(31)19(32)11-30/h5-6,8,12-13,18-19,31-32H,2-4,7,9-11H2,1H3,(H,27,28,29)/t13-,18+,19+/m0/s1 |
| InChIKey | FVGIPNOHPZEJMW-MJXNMMHHSA-N |
| XLogP | 2.43 |
| TPSA | 120.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.59 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |