C25H25N5O4S2 — CID 159757196
(1,1-dioxo-1λ6-thia-6-azaspiro[3.3]heptan-6-yl)-[4-[(6-methoxy-1H-isoindol-5-yl)amino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-7-yl]methanone (PubChem CID 159757196) has the molecular formula C25H25N5O4S2 and a molecular weight of 523.64 g/mol. Its IUPAC name is (1,1-dioxo-1λ6-thia-6-azaspiro[3.3]heptan-6-yl)-[4-[(6-methoxy-1H-isoindol-5-yl)amino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-7-yl]methanone.
| Compound Name | (1,1-dioxo-1λ6-thia-6-azaspiro[3.3]heptan-6-yl)-[4-[(6-methoxy-1H-isoindol-5-yl)amino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-7-yl]methanone |
|---|---|
| PubChem CID | 159757196 |
| Molecular Formula | C25H25N5O4S2 |
| Molecular Weight | 523.64 g/mol |
| Exact Mass | 523.13 |
| IUPAC Name | (1,1-dioxo-1λ6-thia-6-azaspiro[3.3]heptan-6-yl)-[4-[(6-methoxy-1H-isoindol-5-yl)amino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-7-yl]methanone |
| SMILES | COc1cc2c(cc1Nc1ncnc3sc4c(c13)CCC(C(=O)N1CC3(CCS3(=O)=O)C1)C4)C=NC2 |
| InChI | InChI=1S/C25H25N5O4S2/c1-34-19-7-16-10-26-9-15(16)6-18(19)29-22-21-17-3-2-14(8-20(17)35-23(21)28-13-27-22)24(31)30-11-25(12-30)4-5-36(25,32)33/h6-7,9,13-14H,2-5,8,10-12H2,1H3,(H,27,28,29) |
| InChIKey | GUMZEWRCQXGOCV-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 113.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.64 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |