C25H26N6O4S2 — CID 118095979
(1,1-dioxo-1λ6-thia-6-azaspiro[3.3]heptan-6-yl)-[(7S)-4-[(6-ethoxy-1H-indazol-5-yl)amino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-7-yl]methanone (PubChem CID 118095979) has the molecular formula C25H26N6O4S2 and a molecular weight of 538.66 g/mol. Its IUPAC name is (1,1-dioxo-1λ6-thia-6-azaspiro[3.3]heptan-6-yl)-[(7S)-4-[(6-ethoxy-1H-indazol-5-yl)amino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-7-yl]methanone.
| Compound Name | (1,1-dioxo-1λ6-thia-6-azaspiro[3.3]heptan-6-yl)-[(7S)-4-[(6-ethoxy-1H-indazol-5-yl)amino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-7-yl]methanone |
|---|---|
| PubChem CID | 118095979 |
| Molecular Formula | C25H26N6O4S2 |
| Molecular Weight | 538.66 g/mol |
| Exact Mass | 538.15 |
| IUPAC Name | (1,1-dioxo-1λ6-thia-6-azaspiro[3.3]heptan-6-yl)-[(7S)-4-[(6-ethoxy-1H-indazol-5-yl)amino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-7-yl]methanone |
| SMILES | CCOc1cc2[nH]ncc2cc1Nc1ncnc2sc3c(c12)CC[C@H](C(=O)N1CC2(CCS2(=O)=O)C1)C3 |
| InChI | InChI=1S/C25H26N6O4S2/c1-2-35-19-9-17-15(10-28-30-17)7-18(19)29-22-21-16-4-3-14(8-20(16)36-23(21)27-13-26-22)24(32)31-11-25(12-31)5-6-37(25,33)34/h7,9-10,13-14H,2-6,8,11-12H2,1H3,(H,28,30)(H,26,27,29)/t14-/m0/s1 |
| InChIKey | MPPLSBIGBGMQCK-AWEZNQCLSA-N |
| XLogP | 3.21 |
| TPSA | 130.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.66 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |