C24H28N6O4S — CID 118096311
(7S)-4-[(6-ethoxy-1H-indazol-5-yl)amino]-N,N-bis(2-hydroxyethyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine-7-carboxamide (PubChem CID 118096311) has the molecular formula C24H28N6O4S and a molecular weight of 496.59 g/mol. Its IUPAC name is (7S)-4-[(6-ethoxy-1H-indazol-5-yl)amino]-N,N-bis(2-hydroxyethyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine-7-carboxamide.
| Compound Name | (7S)-4-[(6-ethoxy-1H-indazol-5-yl)amino]-N,N-bis(2-hydroxyethyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine-7-carboxamide |
|---|---|
| PubChem CID | 118096311 |
| Molecular Formula | C24H28N6O4S |
| Molecular Weight | 496.59 g/mol |
| Exact Mass | 496.19 |
| IUPAC Name | (7S)-4-[(6-ethoxy-1H-indazol-5-yl)amino]-N,N-bis(2-hydroxyethyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine-7-carboxamide |
| SMILES | CCOc1cc2[nH]ncc2cc1Nc1ncnc2sc3c(c12)CC[C@H](C(=O)N(CCO)CCO)C3 |
| InChI | InChI=1S/C24H28N6O4S/c1-2-34-19-11-17-15(12-27-29-17)9-18(19)28-22-21-16-4-3-14(24(33)30(5-7-31)6-8-32)10-20(16)35-23(21)26-13-25-22/h9,11-14,31-32H,2-8,10H2,1H3,(H,27,29)(H,25,26,28)/t14-/m0/s1 |
| InChIKey | PYNUTMWUBUAUIN-AWEZNQCLSA-N |
| XLogP | 2.63 |
| TPSA | 136.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.59 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |