C22H23ClN6O2S — CID 90015521
4-[[6-(2-chloroethoxy)-1H-indazol-5-yl]amino]-N,N-dimethyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine-7-carboxamide (PubChem CID 90015521) has the molecular formula C22H23ClN6O2S and a molecular weight of 470.99 g/mol. Its IUPAC name is 4-[[6-(2-chloroethoxy)-1H-indazol-5-yl]amino]-N,N-dimethyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine-7-carboxamide.
| Compound Name | 4-[[6-(2-chloroethoxy)-1H-indazol-5-yl]amino]-N,N-dimethyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine-7-carboxamide |
|---|---|
| PubChem CID | 90015521 |
| Molecular Formula | C22H23ClN6O2S |
| Molecular Weight | 470.99 g/mol |
| Exact Mass | 470.13 |
| IUPAC Name | 4-[[6-(2-chloroethoxy)-1H-indazol-5-yl]amino]-N,N-dimethyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine-7-carboxamide |
| SMILES | CN(C)C(=O)C1CCc2c(sc3ncnc(Nc4cc5cn[nH]c5cc4OCCCl)c23)C1 |
| InChI | InChI=1S/C22H23ClN6O2S/c1-29(2)22(30)12-3-4-14-18(8-12)32-21-19(14)20(24-11-25-21)27-16-7-13-10-26-28-15(13)9-17(16)31-6-5-23/h7,9-12H,3-6,8H2,1-2H3,(H,26,28)(H,24,25,27) |
| InChIKey | PHQUYQRYAYGCSH-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 96.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.99 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|