C20H19ClN6OS — CID 123667527
4-[(6-chloro-1H-indazol-5-yl)amino]-N,N-dimethyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine-7-carboxamide (PubChem CID 123667527) has the molecular formula C20H19ClN6OS and a molecular weight of 426.93 g/mol. Its IUPAC name is 4-[(6-chloro-1H-indazol-5-yl)amino]-N,N-dimethyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine-7-carboxamide.
| Compound Name | 4-[(6-chloro-1H-indazol-5-yl)amino]-N,N-dimethyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine-7-carboxamide |
|---|---|
| PubChem CID | 123667527 |
| Molecular Formula | C20H19ClN6OS |
| Molecular Weight | 426.93 g/mol |
| Exact Mass | 426.10 |
| IUPAC Name | 4-[(6-chloro-1H-indazol-5-yl)amino]-N,N-dimethyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine-7-carboxamide |
| SMILES | CN(C)C(=O)C1CCc2c(sc3ncnc(Nc4cc5cn[nH]c5cc4Cl)c23)C1 |
| InChI | InChI=1S/C20H19ClN6OS/c1-27(2)20(28)10-3-4-12-16(6-10)29-19-17(12)18(22-9-23-19)25-15-5-11-8-24-26-14(11)7-13(15)21/h5,7-10H,3-4,6H2,1-2H3,(H,24,26)(H,22,23,25) |
| InChIKey | HJKTXFRQMXZWCT-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 86.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.93 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |