C19H17ClN6OS2 — CID 123715453
4-[(5-chloro-1,2,3-benzothiadiazol-6-yl)amino]-N,N-dimethyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine-7-carboxamide (PubChem CID 123715453) has the molecular formula C19H17ClN6OS2 and a molecular weight of 444.97 g/mol. Its IUPAC name is 4-[(5-chloro-1,2,3-benzothiadiazol-6-yl)amino]-N,N-dimethyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine-7-carboxamide.
| Compound Name | 4-[(5-chloro-1,2,3-benzothiadiazol-6-yl)amino]-N,N-dimethyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine-7-carboxamide |
|---|---|
| PubChem CID | 123715453 |
| Molecular Formula | C19H17ClN6OS2 |
| Molecular Weight | 444.97 g/mol |
| Exact Mass | 444.06 |
| IUPAC Name | 4-[(5-chloro-1,2,3-benzothiadiazol-6-yl)amino]-N,N-dimethyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine-7-carboxamide |
| SMILES | CN(C)C(=O)C1CCc2c(sc3ncnc(Nc4cc5snnc5cc4Cl)c23)C1 |
| InChI | InChI=1S/C19H17ClN6OS2/c1-26(2)19(27)9-3-4-10-14(5-9)28-18-16(10)17(21-8-22-18)23-12-7-15-13(6-11(12)20)24-25-29-15/h6-9H,3-5H2,1-2H3,(H,21,22,23) |
| InChIKey | CXEFFWNINKNMOX-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 83.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.97 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |