C28H38N8O2S2 — CID 140796877
N,N-bis[3-(dimethylamino)propyl]-4-[(5-methoxy-1,2,3-benzothiadiazol-6-yl)amino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine-7-carboxamide (PubChem CID 140796877) has the molecular formula C28H38N8O2S2 and a molecular weight of 582.80 g/mol. Its IUPAC name is N,N-bis[3-(dimethylamino)propyl]-4-[(5-methoxy-1,2,3-benzothiadiazol-6-yl)amino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine-7-carboxamide.
| Compound Name | N,N-bis[3-(dimethylamino)propyl]-4-[(5-methoxy-1,2,3-benzothiadiazol-6-yl)amino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine-7-carboxamide |
|---|---|
| PubChem CID | 140796877 |
| Molecular Formula | C28H38N8O2S2 |
| Molecular Weight | 582.80 g/mol |
| Exact Mass | 582.26 |
| IUPAC Name | N,N-bis[3-(dimethylamino)propyl]-4-[(5-methoxy-1,2,3-benzothiadiazol-6-yl)amino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine-7-carboxamide |
| SMILES | COc1cc2nnsc2cc1Nc1ncnc2sc3c(c12)CCC(C(=O)N(CCCN(C)C)CCCN(C)C)C3 |
| InChI | InChI=1S/C28H38N8O2S2/c1-34(2)10-6-12-36(13-7-11-35(3)4)28(37)18-8-9-19-23(14-18)39-27-25(19)26(29-17-30-27)31-20-16-24-21(32-33-40-24)15-22(20)38-5/h15-18H,6-14H2,1-5H3,(H,29,30,31) |
| InChIKey | GTZUDUNIMKVOOW-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 99.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.80 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |