C22H23ClN6O2S2 — CID 118541538
(7S)-4-[(5-chloro-1,2,3-benzothiadiazol-6-yl)amino]-N-[(2S)-2-methoxypropyl]-N-methyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine-7-carboxamide (PubChem CID 118541538) has the molecular formula C22H23ClN6O2S2 and a molecular weight of 503.05 g/mol. Its IUPAC name is (7S)-4-[(5-chloro-1,2,3-benzothiadiazol-6-yl)amino]-N-[(2S)-2-methoxypropyl]-N-methyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine-7-carboxamide.
| Compound Name | (7S)-4-[(5-chloro-1,2,3-benzothiadiazol-6-yl)amino]-N-[(2S)-2-methoxypropyl]-N-methyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine-7-carboxamide |
|---|---|
| PubChem CID | 118541538 |
| Molecular Formula | C22H23ClN6O2S2 |
| Molecular Weight | 503.05 g/mol |
| Exact Mass | 502.10 |
| IUPAC Name | (7S)-4-[(5-chloro-1,2,3-benzothiadiazol-6-yl)amino]-N-[(2S)-2-methoxypropyl]-N-methyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine-7-carboxamide |
| SMILES | CO[C@@H](C)CN(C)C(=O)[C@H]1CCc2c(sc3ncnc(Nc4cc5snnc5cc4Cl)c23)C1 |
| InChI | InChI=1S/C22H23ClN6O2S2/c1-11(31-3)9-29(2)22(30)12-4-5-13-17(6-12)32-21-19(13)20(24-10-25-21)26-15-8-18-16(7-14(15)23)27-28-33-18/h7-8,10-12H,4-6,9H2,1-3H3,(H,24,25,26)/t11-,12-/m0/s1 |
| InChIKey | AEUVZVSBITUXLJ-RYUDHWBXSA-N |
| XLogP | 4.69 |
| TPSA | 93.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.05 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |