C22H22ClN7O2S2 — CID 118541481
(7S)-4-[(5-chloro-1,2,3-benzothiadiazol-6-yl)amino]-N-[3-(dimethylamino)-3-oxopropyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine-7-carboxamide (PubChem CID 118541481) has the molecular formula C22H22ClN7O2S2 and a molecular weight of 516.05 g/mol. Its IUPAC name is (7S)-4-[(5-chloro-1,2,3-benzothiadiazol-6-yl)amino]-N-[3-(dimethylamino)-3-oxopropyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine-7-carboxamide.
| Compound Name | (7S)-4-[(5-chloro-1,2,3-benzothiadiazol-6-yl)amino]-N-[3-(dimethylamino)-3-oxopropyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine-7-carboxamide |
|---|---|
| PubChem CID | 118541481 |
| Molecular Formula | C22H22ClN7O2S2 |
| Molecular Weight | 516.05 g/mol |
| Exact Mass | 515.10 |
| IUPAC Name | (7S)-4-[(5-chloro-1,2,3-benzothiadiazol-6-yl)amino]-N-[3-(dimethylamino)-3-oxopropyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine-7-carboxamide |
| SMILES | CN(C)C(=O)CCNC(=O)[C@H]1CCc2c(sc3ncnc(Nc4cc5snnc5cc4Cl)c23)C1 |
| InChI | InChI=1S/C22H22ClN7O2S2/c1-30(2)18(31)5-6-24-21(32)11-3-4-12-16(7-11)33-22-19(12)20(25-10-26-22)27-14-9-17-15(8-13(14)23)28-29-34-17/h8-11H,3-7H2,1-2H3,(H,24,32)(H,25,26,27)/t11-/m0/s1 |
| InChIKey | XBCFUVGTJQIRFC-NSHDSACASA-N |
| XLogP | 3.79 |
| TPSA | 113.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.05 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |