C21H22N6O3S2 — CID 140745999
N,N-dimethyl-4-[(6-methylsulfonyl-1H-indazol-5-yl)amino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine-7-carboxamide (PubChem CID 140745999) has the molecular formula C21H22N6O3S2 and a molecular weight of 470.58 g/mol. Its IUPAC name is N,N-dimethyl-4-[(6-methylsulfonyl-1H-indazol-5-yl)amino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine-7-carboxamide.
| Compound Name | N,N-dimethyl-4-[(6-methylsulfonyl-1H-indazol-5-yl)amino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine-7-carboxamide |
|---|---|
| PubChem CID | 140745999 |
| Molecular Formula | C21H22N6O3S2 |
| Molecular Weight | 470.58 g/mol |
| Exact Mass | 470.12 |
| IUPAC Name | N,N-dimethyl-4-[(6-methylsulfonyl-1H-indazol-5-yl)amino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine-7-carboxamide |
| SMILES | CN(C)C(=O)C1CCc2c(sc3ncnc(Nc4cc5cn[nH]c5cc4S(C)(=O)=O)c23)C1 |
| InChI | InChI=1S/C21H22N6O3S2/c1-27(2)21(28)11-4-5-13-16(7-11)31-20-18(13)19(22-10-23-20)25-15-6-12-9-24-26-14(12)8-17(15)32(3,29)30/h6,8-11H,4-5,7H2,1-3H3,(H,24,26)(H,22,23,25) |
| InChIKey | OVAZPOSKYVUDOB-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 120.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.58 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |