C22H23ClN6O3S — CID 121408348
[4-[[6-(2-chloroethoxy)-1H-indazol-5-yl]amino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-7-yl] N,N-dimethylcarbamate (PubChem CID 121408348) has the molecular formula C22H23ClN6O3S and a molecular weight of 486.99 g/mol. Its IUPAC name is [4-[[6-(2-chloroethoxy)-1H-indazol-5-yl]amino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-7-yl] N,N-dimethylcarbamate.
| Compound Name | [4-[[6-(2-chloroethoxy)-1H-indazol-5-yl]amino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-7-yl] N,N-dimethylcarbamate |
|---|---|
| PubChem CID | 121408348 |
| Molecular Formula | C22H23ClN6O3S |
| Molecular Weight | 486.99 g/mol |
| Exact Mass | 486.12 |
| IUPAC Name | [4-[[6-(2-chloroethoxy)-1H-indazol-5-yl]amino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-7-yl] N,N-dimethylcarbamate |
| SMILES | CN(C)C(=O)OC1CCc2c(sc3ncnc(Nc4cc5cn[nH]c5cc4OCCCl)c23)C1 |
| InChI | InChI=1S/C22H23ClN6O3S/c1-29(2)22(30)32-13-3-4-14-18(8-13)33-21-19(14)20(24-11-25-21)27-16-7-12-10-26-28-15(12)9-17(16)31-6-5-23/h7,9-11,13H,3-6,8H2,1-2H3,(H,26,28)(H,24,25,27) |
| InChIKey | MAOVOURGTDFKOS-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 105.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.99 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|