C23H27ClN4O2S — CID 123745939
4-[2-(2-chloroethoxy)-4,5-dimethylanilino]-N,N-dimethyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine-7-carboxamide (PubChem CID 123745939) has the molecular formula C23H27ClN4O2S and a molecular weight of 459.02 g/mol. Its IUPAC name is 4-[2-(2-chloroethoxy)-4,5-dimethylanilino]-N,N-dimethyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine-7-carboxamide.
| Compound Name | 4-[2-(2-chloroethoxy)-4,5-dimethylanilino]-N,N-dimethyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine-7-carboxamide |
|---|---|
| PubChem CID | 123745939 |
| Molecular Formula | C23H27ClN4O2S |
| Molecular Weight | 459.02 g/mol |
| Exact Mass | 458.15 |
| IUPAC Name | 4-[2-(2-chloroethoxy)-4,5-dimethylanilino]-N,N-dimethyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine-7-carboxamide |
| SMILES | Cc1cc(Nc2ncnc3sc4c(c23)CCC(C(=O)N(C)C)C4)c(OCCCl)cc1C |
| InChI | InChI=1S/C23H27ClN4O2S/c1-13-9-17(18(10-14(13)2)30-8-7-24)27-21-20-16-6-5-15(23(29)28(3)4)11-19(16)31-22(20)26-12-25-21/h9-10,12,15H,5-8,11H2,1-4H3,(H,25,26,27) |
| InChIKey | ZNTLAORVXPSCNW-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.02 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|