C16H21N7O2 — CID 19147050
ethyl 4-[5-amino-6-(pyridin-2-ylamino)pyrimidin-4-yl]piperazine-1-carboxylate (PubChem CID 19147050) has the molecular formula C16H21N7O2 and a molecular weight of 343.39 g/mol. Its IUPAC name is ethyl 4-[5-amino-6-(pyridin-2-ylamino)pyrimidin-4-yl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[5-amino-6-(pyridin-2-ylamino)pyrimidin-4-yl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 19147050 |
| Molecular Formula | C16H21N7O2 |
| Molecular Weight | 343.39 g/mol |
| Exact Mass | 343.18 |
| IUPAC Name | ethyl 4-[5-amino-6-(pyridin-2-ylamino)pyrimidin-4-yl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(c2ncnc(Nc3ccccn3)c2N)CC1 |
| InChI | InChI=1S/C16H21N7O2/c1-2-25-16(24)23-9-7-22(8-10-23)15-13(17)14(19-11-20-15)21-12-5-3-4-6-18-12/h3-6,11H,2,7-10,17H2,1H3,(H,18,19,20,21) |
| InChIKey | CXEXOVSFHGJTMG-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 109.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.39 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |