C19H25N7O3 — CID 19150942
ethyl 4-[5-amino-6-[2-(2-methylbenzoyl)hydrazinyl]pyrimidin-4-yl]piperazine-1-carboxylate (PubChem CID 19150942) has the molecular formula C19H25N7O3 and a molecular weight of 399.46 g/mol. Its IUPAC name is ethyl 4-[5-amino-6-[2-(2-methylbenzoyl)hydrazinyl]pyrimidin-4-yl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[5-amino-6-[2-(2-methylbenzoyl)hydrazinyl]pyrimidin-4-yl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 19150942 |
| Molecular Formula | C19H25N7O3 |
| Molecular Weight | 399.46 g/mol |
| Exact Mass | 399.20 |
| IUPAC Name | ethyl 4-[5-amino-6-[2-(2-methylbenzoyl)hydrazinyl]pyrimidin-4-yl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(c2ncnc(NNC(=O)c3ccccc3C)c2N)CC1 |
| InChI | InChI=1S/C19H25N7O3/c1-3-29-19(28)26-10-8-25(9-11-26)17-15(20)16(21-12-22-17)23-24-18(27)14-7-5-4-6-13(14)2/h4-7,12H,3,8-11,20H2,1-2H3,(H,24,27)(H,21,22,23) |
| InChIKey | ZWEVEKLMEWYNJM-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 125.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.46 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|