C16H22N6O — CID 19134881
N'-[5-amino-6-(butylamino)pyrimidin-4-yl]-2-methylbenzohydrazide (PubChem CID 19134881) has the molecular formula C16H22N6O and a molecular weight of 314.39 g/mol. Its IUPAC name is N'-[5-amino-6-(butylamino)pyrimidin-4-yl]-2-methylbenzohydrazide.
| Compound Name | N'-[5-amino-6-(butylamino)pyrimidin-4-yl]-2-methylbenzohydrazide |
|---|---|
| PubChem CID | 19134881 |
| Molecular Formula | C16H22N6O |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.19 |
| IUPAC Name | N'-[5-amino-6-(butylamino)pyrimidin-4-yl]-2-methylbenzohydrazide |
| SMILES | CCCCNc1ncnc(NNC(=O)c2ccccc2C)c1N |
| InChI | InChI=1S/C16H22N6O/c1-3-4-9-18-14-13(17)15(20-10-19-14)21-22-16(23)12-8-6-5-7-11(12)2/h5-8,10H,3-4,9,17H2,1-2H3,(H,22,23)(H2,18,19,20,21) |
| InChIKey | CTECORWZAVEKPU-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 104.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|