C17H24N6O — CID 19150908
N'-[5-amino-6-(3-methylbutylamino)pyrimidin-4-yl]-2-methylbenzohydrazide (PubChem CID 19150908) has the molecular formula C17H24N6O and a molecular weight of 328.42 g/mol. Its IUPAC name is N'-[5-amino-6-(3-methylbutylamino)pyrimidin-4-yl]-2-methylbenzohydrazide.
| Compound Name | N'-[5-amino-6-(3-methylbutylamino)pyrimidin-4-yl]-2-methylbenzohydrazide |
|---|---|
| PubChem CID | 19150908 |
| Molecular Formula | C17H24N6O |
| Molecular Weight | 328.42 g/mol |
| Exact Mass | 328.20 |
| IUPAC Name | N'-[5-amino-6-(3-methylbutylamino)pyrimidin-4-yl]-2-methylbenzohydrazide |
| SMILES | Cc1ccccc1C(=O)NNc1ncnc(NCCC(C)C)c1N |
| InChI | InChI=1S/C17H24N6O/c1-11(2)8-9-19-15-14(18)16(21-10-20-15)22-23-17(24)13-7-5-4-6-12(13)3/h4-7,10-11H,8-9,18H2,1-3H3,(H,23,24)(H2,19,20,21,22) |
| InChIKey | FIIYDZNLKPUWKB-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 104.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.42 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|