C15H21N7O — CID 19151979
N'-[5-amino-6-(3-methylbutylamino)pyrimidin-4-yl]pyridine-2-carbohydrazide (PubChem CID 19151979) has the molecular formula C15H21N7O and a molecular weight of 315.38 g/mol. Its IUPAC name is N'-[5-amino-6-(3-methylbutylamino)pyrimidin-4-yl]pyridine-2-carbohydrazide.
| Compound Name | N'-[5-amino-6-(3-methylbutylamino)pyrimidin-4-yl]pyridine-2-carbohydrazide |
|---|---|
| PubChem CID | 19151979 |
| Molecular Formula | C15H21N7O |
| Molecular Weight | 315.38 g/mol |
| Exact Mass | 315.18 |
| IUPAC Name | N'-[5-amino-6-(3-methylbutylamino)pyrimidin-4-yl]pyridine-2-carbohydrazide |
| SMILES | CC(C)CCNc1ncnc(NNC(=O)c2ccccn2)c1N |
| InChI | InChI=1S/C15H21N7O/c1-10(2)6-8-18-13-12(16)14(20-9-19-13)21-22-15(23)11-5-3-4-7-17-11/h3-5,7,9-10H,6,8,16H2,1-2H3,(H,22,23)(H2,18,19,20,21) |
| InChIKey | ICMZPJFMUBFVBA-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 117.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.38 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|