C20H18N8O — CID 19152023
N'-[5-amino-6-[(2-methylquinolin-5-yl)amino]pyrimidin-4-yl]pyridine-2-carbohydrazide (PubChem CID 19152023) has the molecular formula C20H18N8O and a molecular weight of 386.42 g/mol. Its IUPAC name is N'-[5-amino-6-[(2-methylquinolin-5-yl)amino]pyrimidin-4-yl]pyridine-2-carbohydrazide.
| Compound Name | N'-[5-amino-6-[(2-methylquinolin-5-yl)amino]pyrimidin-4-yl]pyridine-2-carbohydrazide |
|---|---|
| PubChem CID | 19152023 |
| Molecular Formula | C20H18N8O |
| Molecular Weight | 386.42 g/mol |
| Exact Mass | 386.16 |
| IUPAC Name | N'-[5-amino-6-[(2-methylquinolin-5-yl)amino]pyrimidin-4-yl]pyridine-2-carbohydrazide |
| SMILES | Cc1ccc2c(Nc3ncnc(NNC(=O)c4ccccn4)c3N)cccc2n1 |
| InChI | InChI=1S/C20H18N8O/c1-12-8-9-13-14(25-12)6-4-7-15(13)26-18-17(21)19(24-11-23-18)27-28-20(29)16-5-2-3-10-22-16/h2-11H,21H2,1H3,(H,28,29)(H2,23,24,26,27) |
| InChIKey | ZQOADFSTLKCLBN-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 130.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.42 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|