C14H12ClN5 — CID 23477635
6-chloro-4-N-(2-methylquinolin-5-yl)pyrimidine-4,5-diamine (PubChem CID 23477635) has the molecular formula C14H12ClN5 and a molecular weight of 285.74 g/mol. Its IUPAC name is 6-chloro-4-N-(2-methylquinolin-5-yl)pyrimidine-4,5-diamine.
| Compound Name | 6-chloro-4-N-(2-methylquinolin-5-yl)pyrimidine-4,5-diamine |
|---|---|
| PubChem CID | 23477635 |
| Molecular Formula | C14H12ClN5 |
| Molecular Weight | 285.74 g/mol |
| Exact Mass | 285.08 |
| IUPAC Name | 6-chloro-4-N-(2-methylquinolin-5-yl)pyrimidine-4,5-diamine |
| SMILES | Cc1ccc2c(Nc3ncnc(Cl)c3N)cccc2n1 |
| InChI | InChI=1S/C14H12ClN5/c1-8-5-6-9-10(19-8)3-2-4-11(9)20-14-12(16)13(15)17-7-18-14/h2-7H,16H2,1H3,(H,17,18,20) |
| InChIKey | JHLRIDNERJGCLI-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.74 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |