C13H17N7O — CID 19135675
N'-[5-amino-6-(propan-2-ylamino)pyrimidin-4-yl]pyridine-2-carbohydrazide (PubChem CID 19135675) has the molecular formula C13H17N7O and a molecular weight of 287.33 g/mol. Its IUPAC name is N'-[5-amino-6-(propan-2-ylamino)pyrimidin-4-yl]pyridine-2-carbohydrazide.
| Compound Name | N'-[5-amino-6-(propan-2-ylamino)pyrimidin-4-yl]pyridine-2-carbohydrazide |
|---|---|
| PubChem CID | 19135675 |
| Molecular Formula | C13H17N7O |
| Molecular Weight | 287.33 g/mol |
| Exact Mass | 287.15 |
| IUPAC Name | N'-[5-amino-6-(propan-2-ylamino)pyrimidin-4-yl]pyridine-2-carbohydrazide |
| SMILES | CC(C)Nc1ncnc(NNC(=O)c2ccccn2)c1N |
| InChI | InChI=1S/C13H17N7O/c1-8(2)18-11-10(14)12(17-7-16-11)19-20-13(21)9-5-3-4-6-15-9/h3-8H,14H2,1-2H3,(H,20,21)(H2,16,17,18,19) |
| InChIKey | GDOVKDJMKGQFCA-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 117.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.33 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|