C20H27N7O — CID 19140848
N'-[5-amino-6-(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)pyrimidin-4-yl]pyridine-2-carbohydrazide (PubChem CID 19140848) has the molecular formula C20H27N7O and a molecular weight of 381.48 g/mol. Its IUPAC name is N'-[5-amino-6-(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)pyrimidin-4-yl]pyridine-2-carbohydrazide.
| Compound Name | N'-[5-amino-6-(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)pyrimidin-4-yl]pyridine-2-carbohydrazide |
|---|---|
| PubChem CID | 19140848 |
| Molecular Formula | C20H27N7O |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.23 |
| IUPAC Name | N'-[5-amino-6-(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)pyrimidin-4-yl]pyridine-2-carbohydrazide |
| SMILES | CC1(C)CC2CC(C)(CN2c2ncnc(NNC(=O)c3ccccn3)c2N)C1 |
| InChI | InChI=1S/C20H27N7O/c1-19(2)8-13-9-20(3,10-19)11-27(13)17-15(21)16(23-12-24-17)25-26-18(28)14-6-4-5-7-22-14/h4-7,12-13H,8-11,21H2,1-3H3,(H,26,28)(H,23,24,25) |
| InChIKey | XRXXJAQMIRLQID-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 109.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|