C19H28N6S — CID 19140820
4-N-(4,5-dimethyl-1,3-thiazol-2-yl)-6-(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)pyrimidine-4,5-diamine (PubChem CID 19140820) has the molecular formula C19H28N6S and a molecular weight of 372.54 g/mol. Its IUPAC name is 4-N-(4,5-dimethyl-1,3-thiazol-2-yl)-6-(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)pyrimidine-4,5-diamine.
| Compound Name | 4-N-(4,5-dimethyl-1,3-thiazol-2-yl)-6-(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)pyrimidine-4,5-diamine |
|---|---|
| PubChem CID | 19140820 |
| Molecular Formula | C19H28N6S |
| Molecular Weight | 372.54 g/mol |
| Exact Mass | 372.21 |
| IUPAC Name | 4-N-(4,5-dimethyl-1,3-thiazol-2-yl)-6-(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)pyrimidine-4,5-diamine |
| SMILES | Cc1nc(Nc2ncnc(N3CC4(C)CC3CC(C)(C)C4)c2N)sc1C |
| InChI | InChI=1S/C19H28N6S/c1-11-12(2)26-17(23-11)24-15-14(20)16(22-10-21-15)25-9-19(5)7-13(25)6-18(3,4)8-19/h10,13H,6-9,20H2,1-5H3,(H,21,22,23,24) |
| InChIKey | VUQJOSPZFGUNFJ-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 79.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.54 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |