C20H27N3S — CID 98087383
4-[(1S,5S)-1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine (PubChem CID 98087383) has the molecular formula C20H27N3S and a molecular weight of 341.52 g/mol. Its IUPAC name is 4-[(1S,5S)-1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine.
| Compound Name | 4-[(1S,5S)-1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 98087383 |
| Molecular Formula | C20H27N3S |
| Molecular Weight | 341.52 g/mol |
| Exact Mass | 341.19 |
| IUPAC Name | 4-[(1S,5S)-1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine |
| SMILES | CC1(C)C[C@H]2C[C@@](C)(CN2c2ncnc3sc4c(c23)CCCC4)C1 |
| InChI | InChI=1S/C20H27N3S/c1-19(2)8-13-9-20(3,10-19)11-23(13)17-16-14-6-4-5-7-15(14)24-18(16)22-12-21-17/h12-13H,4-11H2,1-3H3/t13-,20+/m0/s1 |
| InChIKey | ZXKKXZFPKWPHJY-RNODOKPDSA-N |
| XLogP | 4.98 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.52 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |