C22H30N6O2 — CID 19140841
N'-[5-amino-6-(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)pyrimidin-4-yl]-2-methoxybenzohydrazide (PubChem CID 19140841) has the molecular formula C22H30N6O2 and a molecular weight of 410.52 g/mol. Its IUPAC name is N'-[5-amino-6-(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)pyrimidin-4-yl]-2-methoxybenzohydrazide.
| Compound Name | N'-[5-amino-6-(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)pyrimidin-4-yl]-2-methoxybenzohydrazide |
|---|---|
| PubChem CID | 19140841 |
| Molecular Formula | C22H30N6O2 |
| Molecular Weight | 410.52 g/mol |
| Exact Mass | 410.24 |
| IUPAC Name | N'-[5-amino-6-(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)pyrimidin-4-yl]-2-methoxybenzohydrazide |
| SMILES | COc1ccccc1C(=O)NNc1ncnc(N2CC3(C)CC2CC(C)(C)C3)c1N |
| InChI | InChI=1S/C22H30N6O2/c1-21(2)9-14-10-22(3,11-21)12-28(14)19-17(23)18(24-13-25-19)26-27-20(29)15-7-5-6-8-16(15)30-4/h5-8,13-14H,9-12,23H2,1-4H3,(H,27,29)(H,24,25,26) |
| InChIKey | SVOIPCWWKNTUPW-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 105.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.52 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|