C12H12ClN5O2 — CID 23477575
N'-(5-amino-6-chloropyrimidin-4-yl)-2-methoxybenzohydrazide (PubChem CID 23477575) has the molecular formula C12H12ClN5O2 and a molecular weight of 293.71 g/mol. Its IUPAC name is N'-(5-amino-6-chloropyrimidin-4-yl)-2-methoxybenzohydrazide.
| Compound Name | N'-(5-amino-6-chloropyrimidin-4-yl)-2-methoxybenzohydrazide |
|---|---|
| PubChem CID | 23477575 |
| Molecular Formula | C12H12ClN5O2 |
| Molecular Weight | 293.71 g/mol |
| Exact Mass | 293.07 |
| IUPAC Name | N'-(5-amino-6-chloropyrimidin-4-yl)-2-methoxybenzohydrazide |
| SMILES | COc1ccccc1C(=O)NNc1ncnc(Cl)c1N |
| InChI | InChI=1S/C12H12ClN5O2/c1-20-8-5-3-2-4-7(8)12(19)18-17-11-9(14)10(13)15-6-16-11/h2-6H,14H2,1H3,(H,18,19)(H,15,16,17) |
| InChIKey | JBHVJYGHUKXMKV-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 102.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.71 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|