C22H25N7O — CID 19139500
N'-[5-amino-6-(4-benzylpiperidin-1-yl)pyrimidin-4-yl]pyridine-2-carbohydrazide (PubChem CID 19139500) has the molecular formula C22H25N7O and a molecular weight of 403.49 g/mol. Its IUPAC name is N'-[5-amino-6-(4-benzylpiperidin-1-yl)pyrimidin-4-yl]pyridine-2-carbohydrazide.
| Compound Name | N'-[5-amino-6-(4-benzylpiperidin-1-yl)pyrimidin-4-yl]pyridine-2-carbohydrazide |
|---|---|
| PubChem CID | 19139500 |
| Molecular Formula | C22H25N7O |
| Molecular Weight | 403.49 g/mol |
| Exact Mass | 403.21 |
| IUPAC Name | N'-[5-amino-6-(4-benzylpiperidin-1-yl)pyrimidin-4-yl]pyridine-2-carbohydrazide |
| SMILES | Nc1c(NNC(=O)c2ccccn2)ncnc1N1CCC(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C22H25N7O/c23-19-20(27-28-22(30)18-8-4-5-11-24-18)25-15-26-21(19)29-12-9-17(10-13-29)14-16-6-2-1-3-7-16/h1-8,11,15,17H,9-10,12-14,23H2,(H,28,30)(H,25,26,27) |
| InChIKey | QKIZMEDEMZGHFU-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 109.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.49 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|