C24H29N5 — CID 22544274
6-(4-benzylpiperidin-1-yl)-4-N-(4-ethylphenyl)pyrimidine-4,5-diamine (PubChem CID 22544274) has the molecular formula C24H29N5 and a molecular weight of 387.53 g/mol. Its IUPAC name is 6-(4-benzylpiperidin-1-yl)-4-N-(4-ethylphenyl)pyrimidine-4,5-diamine.
| Compound Name | 6-(4-benzylpiperidin-1-yl)-4-N-(4-ethylphenyl)pyrimidine-4,5-diamine |
|---|---|
| PubChem CID | 22544274 |
| Molecular Formula | C24H29N5 |
| Molecular Weight | 387.53 g/mol |
| Exact Mass | 387.24 |
| IUPAC Name | 6-(4-benzylpiperidin-1-yl)-4-N-(4-ethylphenyl)pyrimidine-4,5-diamine |
| SMILES | CCc1ccc(Nc2ncnc(N3CCC(Cc4ccccc4)CC3)c2N)cc1 |
| InChI | InChI=1S/C24H29N5/c1-2-18-8-10-21(11-9-18)28-23-22(25)24(27-17-26-23)29-14-12-20(13-15-29)16-19-6-4-3-5-7-19/h3-11,17,20H,2,12-16,25H2,1H3,(H,26,27,28) |
| InChIKey | XPWGHNIQYRDWOI-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.53 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |