C23H27N5 — CID 112960327
3-(4-benzylpiperidin-1-yl)-N-(4-ethylphenyl)-1,2,4-triazin-5-amine (PubChem CID 112960327) has the molecular formula C23H27N5 and a molecular weight of 373.50 g/mol. Its IUPAC name is 3-(4-benzylpiperidin-1-yl)-N-(4-ethylphenyl)-1,2,4-triazin-5-amine.
| Compound Name | 3-(4-benzylpiperidin-1-yl)-N-(4-ethylphenyl)-1,2,4-triazin-5-amine |
|---|---|
| PubChem CID | 112960327 |
| Molecular Formula | C23H27N5 |
| Molecular Weight | 373.50 g/mol |
| Exact Mass | 373.23 |
| IUPAC Name | 3-(4-benzylpiperidin-1-yl)-N-(4-ethylphenyl)-1,2,4-triazin-5-amine |
| SMILES | CCc1ccc(Nc2cnnc(N3CCC(Cc4ccccc4)CC3)n2)cc1 |
| InChI | InChI=1S/C23H27N5/c1-2-18-8-10-21(11-9-18)25-22-17-24-27-23(26-22)28-14-12-20(13-15-28)16-19-6-4-3-5-7-19/h3-11,17,20H,2,12-16H2,1H3,(H,25,26,27) |
| InChIKey | QHDCDAAIMRVNRM-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 53.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.50 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |