C16H21N5O2 — CID 19153151
4-[[5-amino-6-(3-methylbutylamino)pyrimidin-4-yl]amino]benzoic acid (PubChem CID 19153151) has the molecular formula C16H21N5O2 and a molecular weight of 315.38 g/mol. Its IUPAC name is 4-[[5-amino-6-(3-methylbutylamino)pyrimidin-4-yl]amino]benzoic acid.
| Compound Name | 4-[[5-amino-6-(3-methylbutylamino)pyrimidin-4-yl]amino]benzoic acid |
|---|---|
| PubChem CID | 19153151 |
| Molecular Formula | C16H21N5O2 |
| Molecular Weight | 315.38 g/mol |
| Exact Mass | 315.17 |
| IUPAC Name | 4-[[5-amino-6-(3-methylbutylamino)pyrimidin-4-yl]amino]benzoic acid |
| SMILES | CC(C)CCNc1ncnc(Nc2ccc(C(=O)O)cc2)c1N |
| InChI | InChI=1S/C16H21N5O2/c1-10(2)7-8-18-14-13(17)15(20-9-19-14)21-12-5-3-11(4-6-12)16(22)23/h3-6,9-10H,7-8,17H2,1-2H3,(H,22,23)(H2,18,19,20,21) |
| InChIKey | YWSJXPGNPJQETQ-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 113.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.38 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |