C22H27N7O3S — CID 19145319
4-[[5-amino-6-[2-(2-methylbenzoyl)hydrazinyl]pyrimidin-4-yl]amino]-N,N-diethylbenzenesulfonamide (PubChem CID 19145319) has the molecular formula C22H27N7O3S and a molecular weight of 469.57 g/mol. Its IUPAC name is 4-[[5-amino-6-[2-(2-methylbenzoyl)hydrazinyl]pyrimidin-4-yl]amino]-N,N-diethylbenzenesulfonamide.
| Compound Name | 4-[[5-amino-6-[2-(2-methylbenzoyl)hydrazinyl]pyrimidin-4-yl]amino]-N,N-diethylbenzenesulfonamide |
|---|---|
| PubChem CID | 19145319 |
| Molecular Formula | C22H27N7O3S |
| Molecular Weight | 469.57 g/mol |
| Exact Mass | 469.19 |
| IUPAC Name | 4-[[5-amino-6-[2-(2-methylbenzoyl)hydrazinyl]pyrimidin-4-yl]amino]-N,N-diethylbenzenesulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(Nc2ncnc(NNC(=O)c3ccccc3C)c2N)cc1 |
| InChI | InChI=1S/C22H27N7O3S/c1-4-29(5-2)33(31,32)17-12-10-16(11-13-17)26-20-19(23)21(25-14-24-20)27-28-22(30)18-9-7-6-8-15(18)3/h6-14H,4-5,23H2,1-3H3,(H,28,30)(H2,24,25,26,27) |
| InChIKey | XSKJUKWGBYDTDA-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 142.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.57 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|