C21H24FN7O3S — CID 19145323
4-[[5-amino-6-[2-(2-fluorobenzoyl)hydrazinyl]pyrimidin-4-yl]amino]-N,N-diethylbenzenesulfonamide (PubChem CID 19145323) has the molecular formula C21H24FN7O3S and a molecular weight of 473.53 g/mol. Its IUPAC name is 4-[[5-amino-6-[2-(2-fluorobenzoyl)hydrazinyl]pyrimidin-4-yl]amino]-N,N-diethylbenzenesulfonamide.
| Compound Name | 4-[[5-amino-6-[2-(2-fluorobenzoyl)hydrazinyl]pyrimidin-4-yl]amino]-N,N-diethylbenzenesulfonamide |
|---|---|
| PubChem CID | 19145323 |
| Molecular Formula | C21H24FN7O3S |
| Molecular Weight | 473.53 g/mol |
| Exact Mass | 473.16 |
| IUPAC Name | 4-[[5-amino-6-[2-(2-fluorobenzoyl)hydrazinyl]pyrimidin-4-yl]amino]-N,N-diethylbenzenesulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(Nc2ncnc(NNC(=O)c3ccccc3F)c2N)cc1 |
| InChI | InChI=1S/C21H24FN7O3S/c1-3-29(4-2)33(31,32)15-11-9-14(10-12-15)26-19-18(23)20(25-13-24-19)27-28-21(30)16-7-5-6-8-17(16)22/h5-13H,3-4,23H2,1-2H3,(H,28,30)(H2,24,25,26,27) |
| InChIKey | QGXFXRYLMUMODC-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 142.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.53 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|