C15H14FN7O2 — CID 22540559
N'-[5-amino-6-[(5-methyl-1,2-oxazol-3-yl)amino]pyrimidin-4-yl]-2-fluorobenzohydrazide (PubChem CID 22540559) has the molecular formula C15H14FN7O2 and a molecular weight of 343.32 g/mol. Its IUPAC name is N'-[5-amino-6-[(5-methyl-1,2-oxazol-3-yl)amino]pyrimidin-4-yl]-2-fluorobenzohydrazide.
| Compound Name | N'-[5-amino-6-[(5-methyl-1,2-oxazol-3-yl)amino]pyrimidin-4-yl]-2-fluorobenzohydrazide |
|---|---|
| PubChem CID | 22540559 |
| Molecular Formula | C15H14FN7O2 |
| Molecular Weight | 343.32 g/mol |
| Exact Mass | 343.12 |
| IUPAC Name | N'-[5-amino-6-[(5-methyl-1,2-oxazol-3-yl)amino]pyrimidin-4-yl]-2-fluorobenzohydrazide |
| SMILES | Cc1cc(Nc2ncnc(NNC(=O)c3ccccc3F)c2N)no1 |
| InChI | InChI=1S/C15H14FN7O2/c1-8-6-11(23-25-8)20-13-12(17)14(19-7-18-13)21-22-15(24)9-4-2-3-5-10(9)16/h2-7H,17H2,1H3,(H,22,24)(H2,18,19,20,21,23) |
| InChIKey | XMMJNHRZTZLJGC-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 130.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.32 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|