C17H14FN7O3 — CID 23483819
2-fluoro-N'-[6-[(4-methyl-2-pyridinyl)amino]-5-nitropyrimidin-4-yl]benzohydrazide (PubChem CID 23483819) has the molecular formula C17H14FN7O3 and a molecular weight of 383.34 g/mol. Its IUPAC name is 2-fluoro-N'-[6-[(4-methyl-2-pyridinyl)amino]-5-nitropyrimidin-4-yl]benzohydrazide.
| Compound Name | 2-fluoro-N'-[6-[(4-methyl-2-pyridinyl)amino]-5-nitropyrimidin-4-yl]benzohydrazide |
|---|---|
| PubChem CID | 23483819 |
| Molecular Formula | C17H14FN7O3 |
| Molecular Weight | 383.34 g/mol |
| Exact Mass | 383.11 |
| IUPAC Name | 2-fluoro-N'-[6-[(4-methyl-2-pyridinyl)amino]-5-nitropyrimidin-4-yl]benzohydrazide |
| SMILES | Cc1ccnc(Nc2ncnc(NNC(=O)c3ccccc3F)c2[N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H14FN7O3/c1-10-6-7-19-13(8-10)22-15-14(25(27)28)16(21-9-20-15)23-24-17(26)11-4-2-3-5-12(11)18/h2-9H,1H3,(H,24,26)(H2,19,20,21,22,23) |
| InChIKey | PEGLDFGTXCIKEF-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 134.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.34 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|