C20H19FN6O3 — CID 23477804
N'-[6-(N-ethyl-3-methylanilino)-5-nitropyrimidin-4-yl]-2-fluorobenzohydrazide (PubChem CID 23477804) has the molecular formula C20H19FN6O3 and a molecular weight of 410.41 g/mol. Its IUPAC name is N'-[6-(N-ethyl-3-methylanilino)-5-nitropyrimidin-4-yl]-2-fluorobenzohydrazide.
| Compound Name | N'-[6-(N-ethyl-3-methylanilino)-5-nitropyrimidin-4-yl]-2-fluorobenzohydrazide |
|---|---|
| PubChem CID | 23477804 |
| Molecular Formula | C20H19FN6O3 |
| Molecular Weight | 410.41 g/mol |
| Exact Mass | 410.15 |
| IUPAC Name | N'-[6-(N-ethyl-3-methylanilino)-5-nitropyrimidin-4-yl]-2-fluorobenzohydrazide |
| SMILES | CCN(c1cccc(C)c1)c1ncnc(NNC(=O)c2ccccc2F)c1[N+](=O)[O-] |
| InChI | InChI=1S/C20H19FN6O3/c1-3-26(14-8-6-7-13(2)11-14)19-17(27(29)30)18(22-12-23-19)24-25-20(28)15-9-4-5-10-16(15)21/h4-12H,3H2,1-2H3,(H,25,28)(H,22,23,24) |
| InChIKey | YJKDTGLLMCZHFG-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.41 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|