C18H24N4S — CID 19140492
4-(2-ethylpiperidin-1-yl)-6-(4-methylphenyl)sulfanylpyrimidin-5-amine (PubChem CID 19140492) has the molecular formula C18H24N4S and a molecular weight of 328.49 g/mol. Its IUPAC name is 4-(2-ethylpiperidin-1-yl)-6-(4-methylphenyl)sulfanylpyrimidin-5-amine.
| Compound Name | 4-(2-ethylpiperidin-1-yl)-6-(4-methylphenyl)sulfanylpyrimidin-5-amine |
|---|---|
| PubChem CID | 19140492 |
| Molecular Formula | C18H24N4S |
| Molecular Weight | 328.49 g/mol |
| Exact Mass | 328.17 |
| IUPAC Name | 4-(2-ethylpiperidin-1-yl)-6-(4-methylphenyl)sulfanylpyrimidin-5-amine |
| SMILES | CCC1CCCCN1c1ncnc(Sc2ccc(C)cc2)c1N |
| InChI | InChI=1S/C18H24N4S/c1-3-14-6-4-5-11-22(14)17-16(19)18(21-12-20-17)23-15-9-7-13(2)8-10-15/h7-10,12,14H,3-6,11,19H2,1-2H3 |
| InChIKey | FQUALPINFRIREI-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.49 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |